C10H6Cl3F3N2O — CID 163413511
(E)-3-amino-N-(2,4,6-trichlorophenyl)-2-(trifluoromethyl)prop-2-enamide (PubChem CID 163413511) has the molecular formula C10H6Cl3F3N2O and a molecular weight of 333.52 g/mol. Its IUPAC name is (E)-3-amino-N-(2,4,6-trichlorophenyl)-2-(trifluoromethyl)prop-2-enamide.
| Compound Name | (E)-3-amino-N-(2,4,6-trichlorophenyl)-2-(trifluoromethyl)prop-2-enamide |
|---|---|
| PubChem CID | 163413511 |
| Molecular Formula | C10H6Cl3F3N2O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | (E)-3-amino-N-(2,4,6-trichlorophenyl)-2-(trifluoromethyl)prop-2-enamide |
| SMILES | N/C=C(\C(=O)Nc1c(Cl)cc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H6Cl3F3N2O/c11-4-1-6(12)8(7(13)2-4)18-9(19)5(3-17)10(14,15)16/h1-3H,17H2,(H,18,19)/b5-3+ |
| InChIKey | ACMFIXZYIADUQN-HWKANZROSA-N |
| XLogP | 3.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|