C10H4Cl2F7NO2 — CID 3109818
N-(2,6-dichlorophenyl)-2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanamide (PubChem CID 3109818) has the molecular formula C10H4Cl2F7NO2 and a molecular weight of 374.04 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanamide.
| Compound Name | N-(2,6-dichlorophenyl)-2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanamide |
|---|---|
| PubChem CID | 3109818 |
| Molecular Formula | C10H4Cl2F7NO2 |
| Molecular Weight | 374.04 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C10H4Cl2F7NO2/c11-4-2-1-3-5(12)6(4)20-7(21)8(13,14)9(15,16)22-10(17,18)19/h1-3H,(H,20,21) |
| InChIKey | PGYLEDBIXALFCU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.04 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|