C12H4Cl2F11NO2 — CID 163179327
(2R)-N-(2,6-dichlorophenyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide (PubChem CID 163179327) has the molecular formula C12H4Cl2F11NO2 and a molecular weight of 474.05 g/mol. Its IUPAC name is (2R)-N-(2,6-dichlorophenyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide.
| Compound Name | (2R)-N-(2,6-dichlorophenyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 163179327 |
| Molecular Formula | C12H4Cl2F11NO2 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 472.94 |
| IUPAC Name | (2R)-N-(2,6-dichlorophenyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H4Cl2F11NO2/c13-4-2-1-3-5(14)6(4)26-7(27)8(15,10(18,19)20)28-12(24,25)9(16,17)11(21,22)23/h1-3H,(H,26,27)/t8-/m0/s1 |
| InChIKey | YMMLMVKAUSOBLH-QMMMGPOBSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|