C13H4F17N3O3 — CID 163171682
(2S)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-pyrimidin-2-ylpropanamide (PubChem CID 163171682) has the molecular formula C13H4F17N3O3 and a molecular weight of 573.16 g/mol. Its IUPAC name is (2S)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-pyrimidin-2-ylpropanamide.
| Compound Name | (2S)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-pyrimidin-2-ylpropanamide |
|---|---|
| PubChem CID | 163171682 |
| Molecular Formula | C13H4F17N3O3 |
| Molecular Weight | 573.16 g/mol |
| Exact Mass | 573.00 |
| IUPAC Name | (2S)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-pyrimidin-2-ylpropanamide |
| SMILES | O=C(Nc1ncccn1)[C@@](F)(OC(F)(F)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H4F17N3O3/c14-6(9(18,19)20,4(34)33-5-31-2-1-3-32-5)35-13(29,30)8(17,11(24,25)26)36-12(27,28)7(15,16)10(21,22)23/h1-3H,(H,31,32,33,34)/t6-,8+/m1/s1 |
| InChIKey | VPTHWNGRLDBEJL-SVRRBLITSA-N |
| XLogP | 5.29 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.16 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|