C16H8F17NO3 — CID 95239983
(2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-methylphenyl)propanamide (PubChem CID 95239983) has the molecular formula C16H8F17NO3 and a molecular weight of 585.21 g/mol. Its IUPAC name is (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-methylphenyl)propanamide.
| Compound Name | (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 95239983 |
| Molecular Formula | C16H8F17NO3 |
| Molecular Weight | 585.21 g/mol |
| Exact Mass | 585.02 |
| IUPAC Name | (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)[C@](F)(OC(F)(F)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F17NO3/c1-6-3-2-4-7(5-6)34-8(35)9(17,12(21,22)23)36-16(32,33)11(20,14(27,28)29)37-15(30,31)10(18,19)13(24,25)26/h2-5H,1H3,(H,34,35)/t9-,11+/m0/s1 |
| InChIKey | ALUPYVAKNUAKRF-GXSJLCMTSA-N |
| XLogP | 6.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.21 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|