C12H6F11N2O4- — CID 163160634
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-[3-[hydroxy(oxido)amino]phenyl]propanamide (PubChem CID 163160634) has the molecular formula C12H6F11N2O4- and a molecular weight of 451.17 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-[3-[hydroxy(oxido)amino]phenyl]propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-[3-[hydroxy(oxido)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 163160634 |
| Molecular Formula | C12H6F11N2O4- |
| Molecular Weight | 451.17 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-[3-[hydroxy(oxido)amino]phenyl]propanamide |
| SMILES | O=C(Nc1cccc(N([O-])O)c1)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H6F11N2O4/c13-8(10(16,17)18,29-12(22,23)9(14,15)11(19,20)21)7(26)24-5-2-1-3-6(4-5)25(27)28/h1-4,27H,(H,24,26)/q-1 |
| InChIKey | HJMLNLVGNGCVCE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.17 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|