C14H10F11NO2 — CID 163178934
(2R)-N-(3,4-dimethylphenyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide (PubChem CID 163178934) has the molecular formula C14H10F11NO2 and a molecular weight of 433.22 g/mol. Its IUPAC name is (2R)-N-(3,4-dimethylphenyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide.
| Compound Name | (2R)-N-(3,4-dimethylphenyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 163178934 |
| Molecular Formula | C14H10F11NO2 |
| Molecular Weight | 433.22 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (2R)-N-(3,4-dimethylphenyl)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C14H10F11NO2/c1-6-3-4-8(5-7(6)2)26-9(27)10(15,12(18,19)20)28-14(24,25)11(16,17)13(21,22)23/h3-5H,1-2H3,(H,26,27)/t10-/m0/s1 |
| InChIKey | YIQYJZOWNCTIOS-JTQLQIEISA-N |
| XLogP | 5.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.22 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|