C16H8F17NO3S — CID 3119877
2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-methylsulfanylphenyl)propanamide (PubChem CID 3119877) has the molecular formula C16H8F17NO3S and a molecular weight of 617.28 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-methylsulfanylphenyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-methylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 3119877 |
| Molecular Formula | C16H8F17NO3S |
| Molecular Weight | 617.28 g/mol |
| Exact Mass | 617.00 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-(3-methylsulfanylphenyl)propanamide |
| SMILES | CSc1cccc(NC(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F17NO3S/c1-38-7-4-2-3-6(5-7)34-8(35)9(17,12(21,22)23)36-16(32,33)11(20,14(27,28)29)37-15(30,31)10(18,19)13(24,25)26/h2-5H,1H3,(H,34,35) |
| InChIKey | BDBKWMAPSFGRDO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.28 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|