C14H5F17N2O3 — CID 163045506
(2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-pyridin-3-ylpropanamide (PubChem CID 163045506) has the molecular formula C14H5F17N2O3 and a molecular weight of 572.17 g/mol. Its IUPAC name is (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-pyridin-3-ylpropanamide.
| Compound Name | (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 163045506 |
| Molecular Formula | C14H5F17N2O3 |
| Molecular Weight | 572.17 g/mol |
| Exact Mass | 572.00 |
| IUPAC Name | (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N-pyridin-3-ylpropanamide |
| SMILES | O=C(Nc1cccnc1)[C@](F)(OC(F)(F)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H5F17N2O3/c15-7(10(19,20)21,6(34)33-5-2-1-3-32-4-5)35-14(30,31)9(18,12(25,26)27)36-13(28,29)8(16,17)11(22,23)24/h1-4H,(H,33,34)/t7-,9-/m0/s1 |
| InChIKey | NJQMVAGTWMQZRM-CBAPKCEASA-N |
| XLogP | 5.89 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.17 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|