C12H7F11N2O2 — CID 71672267
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(3-methyl-2-pyridinyl)propanamide (PubChem CID 71672267) has the molecular formula C12H7F11N2O2 and a molecular weight of 420.18 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(3-methyl-2-pyridinyl)propanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(3-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 71672267 |
| Molecular Formula | C12H7F11N2O2 |
| Molecular Weight | 420.18 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(3-methyl-2-pyridinyl)propanamide |
| SMILES | Cc1cccnc1NC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H7F11N2O2/c1-5-3-2-4-24-6(5)25-7(26)8(13,10(16,17)18)27-12(22,23)9(14,15)11(19,20)21/h2-4H,1H3,(H,24,25,26) |
| InChIKey | VRPICMWGCVLWPM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.18 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|