C11H13F3N2O3 — CID 7045261
methyl (2R)-3,3,3-trifluoro-2-methoxy-2-[(3-methyl-2-pyridinyl)amino]propanoate (PubChem CID 7045261) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is methyl (2R)-3,3,3-trifluoro-2-methoxy-2-[(3-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl (2R)-3,3,3-trifluoro-2-methoxy-2-[(3-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 7045261 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | methyl (2R)-3,3,3-trifluoro-2-methoxy-2-[(3-methyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)[C@@](Nc1ncccc1C)(OC)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O3/c1-7-5-4-6-15-8(7)16-10(19-3,9(17)18-2)11(12,13)14/h4-6H,1-3H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | CVINXYUQONWBRQ-SNVBAGLBSA-N |
| XLogP | 1.88 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|