C17H15ClF3N3O3 — CID 5146392
methyl 2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoro-2-[(3-methyl-2-pyridinyl)amino]propanoate (PubChem CID 5146392) has the molecular formula C17H15ClF3N3O3 and a molecular weight of 401.77 g/mol. Its IUPAC name is methyl 2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoro-2-[(3-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoro-2-[(3-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 5146392 |
| Molecular Formula | C17H15ClF3N3O3 |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | methyl 2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoro-2-[(3-methyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)c1cccc(Cl)c1)(Nc1ncccc1C)C(F)(F)F |
| InChI | InChI=1S/C17H15ClF3N3O3/c1-10-5-4-8-22-13(10)23-16(15(26)27-2,17(19,20)21)24-14(25)11-6-3-7-12(18)9-11/h3-9H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | GAPNGCFKIBYSMY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|