C18H15Cl2F3N2O3 — CID 2802328
ethyl 2-(3-chloroanilino)-2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoate (PubChem CID 2802328) has the molecular formula C18H15Cl2F3N2O3 and a molecular weight of 435.23 g/mol. Its IUPAC name is ethyl 2-(3-chloroanilino)-2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-(3-chloroanilino)-2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 2802328 |
| Molecular Formula | C18H15Cl2F3N2O3 |
| Molecular Weight | 435.23 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | ethyl 2-(3-chloroanilino)-2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(NC(=O)c1cccc(Cl)c1)(Nc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C18H15Cl2F3N2O3/c1-2-28-16(27)17(18(21,22)23,24-14-8-4-7-13(20)10-14)25-15(26)11-5-3-6-12(19)9-11/h3-10,24H,2H2,1H3,(H,25,26) |
| InChIKey | GYXWWZDSCWFVJN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|