C21H21F3N2O5 — CID 4103973
ethyl 2-(3-acetylanilino)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]propanoate (PubChem CID 4103973) has the molecular formula C21H21F3N2O5 and a molecular weight of 438.40 g/mol. Its IUPAC name is ethyl 2-(3-acetylanilino)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]propanoate.
| Compound Name | ethyl 2-(3-acetylanilino)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 4103973 |
| Molecular Formula | C21H21F3N2O5 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | ethyl 2-(3-acetylanilino)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccc(OC)cc1)(Nc1cccc(C(C)=O)c1)C(F)(F)F |
| InChI | InChI=1S/C21H21F3N2O5/c1-4-31-19(29)20(21(22,23)24,25-16-7-5-6-15(12-16)13(2)27)26-18(28)14-8-10-17(30-3)11-9-14/h5-12,25H,4H2,1-3H3,(H,26,28) |
| InChIKey | QELAHHQGBBGHLL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|