C20H18F6N2O4 — CID 4103970
ethyl 3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]-2-[2-(trifluoromethyl)anilino]propanoate (PubChem CID 4103970) has the molecular formula C20H18F6N2O4 and a molecular weight of 464.36 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]-2-[2-(trifluoromethyl)anilino]propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]-2-[2-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 4103970 |
| Molecular Formula | C20H18F6N2O4 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]-2-[2-(trifluoromethyl)anilino]propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccc(OC)cc1)(Nc1ccccc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H18F6N2O4/c1-3-32-17(30)18(20(24,25)26,27-15-7-5-4-6-14(15)19(21,22)23)28-16(29)12-8-10-13(31-2)11-9-12/h4-11,27H,3H2,1-2H3,(H,28,29) |
| InChIKey | RWEAROVJUPSSOS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|