C19H14ClF7N2O3 — CID 579419
ethyl 2-[4-chloro-2-(trifluoromethyl)anilino]-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]propanoate (PubChem CID 579419) has the molecular formula C19H14ClF7N2O3 and a molecular weight of 486.77 g/mol. Its IUPAC name is ethyl 2-[4-chloro-2-(trifluoromethyl)anilino]-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]propanoate.
| Compound Name | ethyl 2-[4-chloro-2-(trifluoromethyl)anilino]-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 579419 |
| Molecular Formula | C19H14ClF7N2O3 |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | ethyl 2-[4-chloro-2-(trifluoromethyl)anilino]-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccccc1F)(Nc1ccc(Cl)cc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H14ClF7N2O3/c1-2-32-16(31)17(19(25,26)27,29-15(30)11-5-3-4-6-13(11)21)28-14-8-7-10(20)9-12(14)18(22,23)24/h3-9,28H,2H2,1H3,(H,29,30) |
| InChIKey | CZBFFNBFQORDDJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|