C19H19F4N3O5S — CID 92849426
ethyl (2R)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[2-(4-methylphenyl)sulfonylhydrazinyl]propanoate (PubChem CID 92849426) has the molecular formula C19H19F4N3O5S and a molecular weight of 477.44 g/mol. Its IUPAC name is ethyl (2R)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[2-(4-methylphenyl)sulfonylhydrazinyl]propanoate.
| Compound Name | ethyl (2R)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[2-(4-methylphenyl)sulfonylhydrazinyl]propanoate |
|---|---|
| PubChem CID | 92849426 |
| Molecular Formula | C19H19F4N3O5S |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | ethyl (2R)-3,3,3-trifluoro-2-[(2-fluorobenzoyl)amino]-2-[2-(4-methylphenyl)sulfonylhydrazinyl]propanoate |
| SMILES | CCOC(=O)[C@](NNS(=O)(=O)c1ccc(C)cc1)(NC(=O)c1ccccc1F)C(F)(F)F |
| InChI | InChI=1S/C19H19F4N3O5S/c1-3-31-17(28)18(19(21,22)23,24-16(27)14-6-4-5-7-15(14)20)25-26-32(29,30)13-10-8-12(2)9-11-13/h4-11,25-26H,3H2,1-2H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | BXLUBTQKJFERGD-GOSISDBHSA-N |
| XLogP | 2.17 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|