C18H19F3N4O5S — CID 4117190
ethyl 2-benzamido-3,3,3-trifluoro-2-[2-(4-sulfamoylphenyl)hydrazinyl]propanoate (PubChem CID 4117190) has the molecular formula C18H19F3N4O5S and a molecular weight of 460.43 g/mol. Its IUPAC name is ethyl 2-benzamido-3,3,3-trifluoro-2-[2-(4-sulfamoylphenyl)hydrazinyl]propanoate.
| Compound Name | ethyl 2-benzamido-3,3,3-trifluoro-2-[2-(4-sulfamoylphenyl)hydrazinyl]propanoate |
|---|---|
| PubChem CID | 4117190 |
| Molecular Formula | C18H19F3N4O5S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | ethyl 2-benzamido-3,3,3-trifluoro-2-[2-(4-sulfamoylphenyl)hydrazinyl]propanoate |
| SMILES | CCOC(=O)C(NNc1ccc(S(N)(=O)=O)cc1)(NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H19F3N4O5S/c1-2-30-16(27)17(18(19,20)21,23-15(26)12-6-4-3-5-7-12)25-24-13-8-10-14(11-9-13)31(22,28)29/h3-11,24-25H,2H2,1H3,(H,23,26)(H2,22,28,29) |
| InChIKey | GYULJJZHKCLXSV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|