C19H19F3N2O3 — CID 7037329
ethyl (2S)-2-benzamido-3,3,3-trifluoro-2-(3-methylanilino)propanoate (PubChem CID 7037329) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is ethyl (2S)-2-benzamido-3,3,3-trifluoro-2-(3-methylanilino)propanoate.
| Compound Name | ethyl (2S)-2-benzamido-3,3,3-trifluoro-2-(3-methylanilino)propanoate |
|---|---|
| PubChem CID | 7037329 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl (2S)-2-benzamido-3,3,3-trifluoro-2-(3-methylanilino)propanoate |
| SMILES | CCOC(=O)[C@@](NC(=O)c1ccccc1)(Nc1cccc(C)c1)C(F)(F)F |
| InChI | InChI=1S/C19H19F3N2O3/c1-3-27-17(26)18(19(20,21)22,23-15-11-7-8-13(2)12-15)24-16(25)14-9-5-4-6-10-14/h4-12,23H,3H2,1-2H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | PNTKESUTOCDXCC-SFHVURJKSA-N |
| XLogP | 3.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|