C19H17ClF4N2O3 — CID 42555442
ethyl (2R)-2-(3-chloro-4-fluoroanilino)-3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]propanoate (PubChem CID 42555442) has the molecular formula C19H17ClF4N2O3 and a molecular weight of 432.80 g/mol. Its IUPAC name is ethyl (2R)-2-(3-chloro-4-fluoroanilino)-3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]propanoate.
| Compound Name | ethyl (2R)-2-(3-chloro-4-fluoroanilino)-3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 42555442 |
| Molecular Formula | C19H17ClF4N2O3 |
| Molecular Weight | 432.80 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | ethyl (2R)-2-(3-chloro-4-fluoroanilino)-3,3,3-trifluoro-2-[(3-methylbenzoyl)amino]propanoate |
| SMILES | CCOC(=O)[C@](NC(=O)c1cccc(C)c1)(Nc1ccc(F)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C19H17ClF4N2O3/c1-3-29-17(28)18(19(22,23)24,25-13-7-8-15(21)14(20)10-13)26-16(27)12-6-4-5-11(2)9-12/h4-10,25H,3H2,1-2H3,(H,26,27)/t18-/m1/s1 |
| InChIKey | KBHCRQNZQKVUJZ-GOSISDBHSA-N |
| XLogP | 4.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|