C22H18Cl2F6N2O6 — CID 98307516
ethyl (2R)-2-[4-[[(2S)-2-[(2,4-dichlorobenzoyl)amino]-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl]amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 98307516) has the molecular formula C22H18Cl2F6N2O6 and a molecular weight of 591.29 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[[(2S)-2-[(2,4-dichlorobenzoyl)amino]-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl]amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl (2R)-2-[4-[[(2S)-2-[(2,4-dichlorobenzoyl)amino]-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl]amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 98307516 |
| Molecular Formula | C22H18Cl2F6N2O6 |
| Molecular Weight | 591.29 g/mol |
| Exact Mass | 590.04 |
| IUPAC Name | ethyl (2R)-2-[4-[[(2S)-2-[(2,4-dichlorobenzoyl)amino]-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl]amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@](O)(c1ccc(N[C@](NC(=O)c2ccc(Cl)cc2Cl)(C(=O)OC)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H18Cl2F6N2O6/c1-3-38-17(34)19(36,21(25,26)27)11-4-7-13(8-5-11)31-20(18(35)37-2,22(28,29)30)32-16(33)14-9-6-12(23)10-15(14)24/h4-10,31,36H,3H2,1-2H3,(H,32,33)/t19-,20+/m1/s1 |
| InChIKey | KRHOZLMRCOLWCE-UXHICEINSA-N |
| XLogP | 4.58 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|