C19H14Cl2F3N3O3S — CID 5238902
methyl 2-[(2,4-dichlorobenzoyl)amino]-3,3,3-trifluoro-2-[(6-methyl-1,3-benzothiazol-2-yl)amino]propanoate (PubChem CID 5238902) has the molecular formula C19H14Cl2F3N3O3S and a molecular weight of 492.31 g/mol. Its IUPAC name is methyl 2-[(2,4-dichlorobenzoyl)amino]-3,3,3-trifluoro-2-[(6-methyl-1,3-benzothiazol-2-yl)amino]propanoate.
| Compound Name | methyl 2-[(2,4-dichlorobenzoyl)amino]-3,3,3-trifluoro-2-[(6-methyl-1,3-benzothiazol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 5238902 |
| Molecular Formula | C19H14Cl2F3N3O3S |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | methyl 2-[(2,4-dichlorobenzoyl)amino]-3,3,3-trifluoro-2-[(6-methyl-1,3-benzothiazol-2-yl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(Cl)cc1Cl)(Nc1nc2ccc(C)cc2s1)C(F)(F)F |
| InChI | InChI=1S/C19H14Cl2F3N3O3S/c1-9-3-6-13-14(7-9)31-17(25-13)27-18(16(29)30-2,19(22,23)24)26-15(28)11-5-4-10(20)8-12(11)21/h3-8H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | CVTOQKCXXFWZIT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|