C16H11ClFN3OS2 — CID 1396408
2-chloro-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-4-methylbenzamide (PubChem CID 1396408) has the molecular formula C16H11ClFN3OS2 and a molecular weight of 379.87 g/mol. Its IUPAC name is 2-chloro-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 1396408 |
| Molecular Formula | C16H11ClFN3OS2 |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2-chloro-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2nc3ccc(F)cc3s2)c(Cl)c1 |
| InChI | InChI=1S/C16H11ClFN3OS2/c1-8-2-4-10(11(17)6-8)14(22)20-15(23)21-16-19-12-5-3-9(18)7-13(12)24-16/h2-7H,1H3,(H2,19,20,21,22,23) |
| InChIKey | CKHGWCFIJJWTOK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|