C19H12FN3OS2 — CID 1421918
N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]naphthalene-1-carboxamide (PubChem CID 1421918) has the molecular formula C19H12FN3OS2 and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 1421918 |
| Molecular Formula | C19H12FN3OS2 |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc2ccc(F)cc2s1)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H12FN3OS2/c20-12-8-9-15-16(10-12)26-19(21-15)23-18(25)22-17(24)14-7-3-5-11-4-1-2-6-13(11)14/h1-10H,(H2,21,22,23,24,25) |
| InChIKey | YRVKXCXUKVBYAP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|