C16H10FN3O2S — CID 35533618
2-(1,2-benzoxazol-3-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 35533618) has the molecular formula C16H10FN3O2S and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 35533618 |
| Molecular Formula | C16H10FN3O2S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(Cc1noc2ccccc12)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C16H10FN3O2S/c17-9-5-6-11-14(7-9)23-16(18-11)19-15(21)8-12-10-3-1-2-4-13(10)22-20-12/h1-7H,8H2,(H,18,19,21) |
| InChIKey | MYBINLYWXYGFHO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |