C15H8FN5OS3 — CID 2033808
N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 2033808) has the molecular formula C15H8FN5OS3 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 2033808 |
| Molecular Formula | C15H8FN5OS3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc2ccc(F)cc2s1)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C15H8FN5OS3/c16-8-2-4-10-12(6-8)24-15(17-10)19-14(23)18-13(22)7-1-3-9-11(5-7)21-25-20-9/h1-6H,(H2,17,18,19,22,23) |
| InChIKey | VOHKFCGZJWVQIM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|