C15H9FN4O3S2 — CID 19629220
4-fluoro-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 19629220) has the molecular formula C15H9FN4O3S2 and a molecular weight of 376.39 g/mol. Its IUPAC name is 4-fluoro-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 4-fluoro-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 19629220 |
| Molecular Formula | C15H9FN4O3S2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 4-fluoro-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1nc2ccc([N+](=O)[O-])cc2s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H9FN4O3S2/c16-9-3-1-8(2-4-9)13(21)18-14(24)19-15-17-11-6-5-10(20(22)23)7-12(11)25-15/h1-7H,(H2,17,18,19,21,24) |
| InChIKey | DQXKIJCTMLYHGS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|