C16H11ClN4O3S2 — CID 19631609
3-chloro-4-methyl-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 19631609) has the molecular formula C16H11ClN4O3S2 and a molecular weight of 406.88 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 3-chloro-4-methyl-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 19631609 |
| Molecular Formula | C16H11ClN4O3S2 |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 3-chloro-4-methyl-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1Cl |
| InChI | InChI=1S/C16H11ClN4O3S2/c1-8-2-3-9(6-11(8)17)14(22)19-15(25)20-16-18-12-5-4-10(21(23)24)7-13(12)26-16/h2-7H,1H3,(H2,18,19,20,22,25) |
| InChIKey | UMLFQSYZYVANGA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|