C15H8Cl2N4O3S2 — CID 22778621
3,4-dichloro-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 22778621) has the molecular formula C15H8Cl2N4O3S2 and a molecular weight of 427.29 g/mol. Its IUPAC name is 3,4-dichloro-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 22778621 |
| Molecular Formula | C15H8Cl2N4O3S2 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 425.94 |
| IUPAC Name | 3,4-dichloro-N-[(6-nitro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1nc2ccc([N+](=O)[O-])cc2s1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H8Cl2N4O3S2/c16-9-3-1-7(5-10(9)17)13(22)19-14(25)20-15-18-11-4-2-8(21(23)24)6-12(11)26-15/h1-6H,(H2,18,19,20,22,25) |
| InChIKey | KQIQOIWURXUTSO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|