C11H12N4O3S2 — CID 58681271
1-[(2S)-1-hydroxypropan-2-yl]-3-(6-nitro-1,3-benzothiazol-2-yl)thiourea (PubChem CID 58681271) has the molecular formula C11H12N4O3S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxypropan-2-yl]-3-(6-nitro-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-[(2S)-1-hydroxypropan-2-yl]-3-(6-nitro-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 58681271 |
| Molecular Formula | C11H12N4O3S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 1-[(2S)-1-hydroxypropan-2-yl]-3-(6-nitro-1,3-benzothiazol-2-yl)thiourea |
| SMILES | C[C@@H](CO)NC(=S)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C11H12N4O3S2/c1-6(5-16)12-10(19)14-11-13-8-3-2-7(15(17)18)4-9(8)20-11/h2-4,6,16H,5H2,1H3,(H2,12,13,14,19)/t6-/m0/s1 |
| InChIKey | BUNCCRJSCQBDOF-LURJTMIESA-N |
| XLogP | 1.87 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|