C15H12N5O2S2 — CID 75202437
CID 75202437 (PubChem CID 75202437) has the molecular formula C15H12N5O2S2 and a molecular weight of 358.43 g/mol.
| Compound Name | CID 75202437 |
|---|---|
| PubChem CID | 75202437 |
| Molecular Formula | C15H12N5O2S2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | — |
| SMILES | C/C(=N\NC(=S)Nc1nc2ccc([N+](=O)[O-])cc2s1)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C15H12N5O2S2/c1-9(10-4-2-3-5-10)18-19-14(23)17-15-16-12-7-6-11(20(21)22)8-13(12)24-15/h2-8H,1H3,(H2,16,17,19,23)/b18-9+ |
| InChIKey | HUYGTTQBEXHPIF-GIJQJNRQSA-N |
| XLogP | 3.27 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|