C16H12FN5O3S — CID 71525292
1-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-(6-nitro-1,3-benzothiazol-2-yl)urea (PubChem CID 71525292) has the molecular formula C16H12FN5O3S and a molecular weight of 373.37 g/mol. Its IUPAC name is 1-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-(6-nitro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-(6-nitro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 71525292 |
| Molecular Formula | C16H12FN5O3S |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 1-[(E)-1-(4-fluorophenyl)ethylideneamino]-3-(6-nitro-1,3-benzothiazol-2-yl)urea |
| SMILES | C/C(=N\NC(=O)Nc1nc2ccc([N+](=O)[O-])cc2s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12FN5O3S/c1-9(10-2-4-11(17)5-3-10)20-21-15(23)19-16-18-13-7-6-12(22(24)25)8-14(13)26-16/h2-8H,1H3,(H2,18,19,21,23)/b20-9+ |
| InChIKey | RHBDMAOTODLYOG-AWQFTUOYSA-N |
| XLogP | 3.89 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|