C15H10F2N4O3S — CID 23549200
1-[(3,5-difluorophenyl)methyl]-3-(6-nitro-1,3-benzothiazol-2-yl)urea (PubChem CID 23549200) has the molecular formula C15H10F2N4O3S and a molecular weight of 364.33 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3-(6-nitro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3-(6-nitro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 23549200 |
| Molecular Formula | C15H10F2N4O3S |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3-(6-nitro-1,3-benzothiazol-2-yl)urea |
| SMILES | O=C(NCc1cc(F)cc(F)c1)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C15H10F2N4O3S/c16-9-3-8(4-10(17)5-9)7-18-14(22)20-15-19-12-2-1-11(21(23)24)6-13(12)25-15/h1-6H,7H2,(H2,18,19,20,22) |
| InChIKey | KJRGJVACDBJULR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|