C13H15N5O2S2 — CID 10131914
4-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)piperazine-1-carbothioamide (PubChem CID 10131914) has the molecular formula C13H15N5O2S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)piperazine-1-carbothioamide.
| Compound Name | 4-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 10131914 |
| Molecular Formula | C13H15N5O2S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)piperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)Nc2nc3ccc([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C13H15N5O2S2/c1-16-4-6-17(7-5-16)13(21)15-12-14-10-3-2-9(18(19)20)8-11(10)22-12/h2-3,8H,4-7H2,1H3,(H,14,15,21) |
| InChIKey | BXEKOCCRIIQZNU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|