C21H21N5O2S2 — CID 85336779
N-(6-nitro-1,3-benzothiazol-2-yl)-4-(3-phenylprop-2-enyl)piperazine-1-carbothioamide (PubChem CID 85336779) has the molecular formula C21H21N5O2S2 and a molecular weight of 439.57 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-4-(3-phenylprop-2-enyl)piperazine-1-carbothioamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-4-(3-phenylprop-2-enyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 85336779 |
| Molecular Formula | C21H21N5O2S2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-4-(3-phenylprop-2-enyl)piperazine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc2nc(NC(=S)N3CCN(CC=Cc4ccccc4)CC3)sc2c1 |
| InChI | InChI=1S/C21H21N5O2S2/c27-26(28)17-8-9-18-19(15-17)30-20(22-18)23-21(29)25-13-11-24(12-14-25)10-4-7-16-5-2-1-3-6-16/h1-9,15H,10-14H2,(H,22,23,29) |
| InChIKey | NVEFOSZACTVRCX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|