C20H21Cl2N3S — CID 19655391
N-(3,5-dichlorophenyl)-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioamide (PubChem CID 19655391) has the molecular formula C20H21Cl2N3S and a molecular weight of 406.38 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19655391 |
| Molecular Formula | C20H21Cl2N3S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioamide |
| SMILES | S=C(Nc1cc(Cl)cc(Cl)c1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21Cl2N3S/c21-17-13-18(22)15-19(14-17)23-20(26)25-11-9-24(10-12-25)8-4-7-16-5-2-1-3-6-16/h1-7,13-15H,8-12H2,(H,23,26)/b7-4+ |
| InChIKey | IZQYBHOQKSNXGI-QPJJXVBHSA-N |
| XLogP | 5.02 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|