C27H29N3S — CID 74227364
N-benzhydryl-4-[(Z)-3-phenylprop-2-enyl]piperazine-1-carbothioamide (PubChem CID 74227364) has the molecular formula C27H29N3S and a molecular weight of 427.62 g/mol. Its IUPAC name is N-benzhydryl-4-[(Z)-3-phenylprop-2-enyl]piperazine-1-carbothioamide.
| Compound Name | N-benzhydryl-4-[(Z)-3-phenylprop-2-enyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 74227364 |
| Molecular Formula | C27H29N3S |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-benzhydryl-4-[(Z)-3-phenylprop-2-enyl]piperazine-1-carbothioamide |
| SMILES | S=C(NC(c1ccccc1)c1ccccc1)N1CCN(C/C=C\c2ccccc2)CC1 |
| InChI | InChI=1S/C27H29N3S/c31-27(28-26(24-14-6-2-7-15-24)25-16-8-3-9-17-25)30-21-19-29(20-22-30)18-10-13-23-11-4-1-5-12-23/h1-17,26H,18-22H2,(H,28,31)/b13-10- |
| InChIKey | NIHXBHNKWHFNPJ-RAXLEYEMSA-N |
| XLogP | 4.98 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|