C21H25N3S — CID 1318610
N-(2-methylphenyl)-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioamide (PubChem CID 1318610) has the molecular formula C21H25N3S and a molecular weight of 351.52 g/mol. Its IUPAC name is N-(2-methylphenyl)-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioamide.
| Compound Name | N-(2-methylphenyl)-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1318610 |
| Molecular Formula | C21H25N3S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-(2-methylphenyl)-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccccc1NC(=S)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25N3S/c1-18-8-5-6-12-20(18)22-21(25)24-16-14-23(15-17-24)13-7-11-19-9-3-2-4-10-19/h2-12H,13-17H2,1H3,(H,22,25)/b11-7+ |
| InChIKey | JXADUNHGNUPGCU-YRNVUSSQSA-N |
| XLogP | 4.02 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|