C22H23ClN2O — CID 6058638
(E)-3-(3-chlorophenyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 6058638) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chlorophenyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6058638 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23ClN2O/c23-21-10-4-8-20(18-21)11-12-22(26)25-16-14-24(15-17-25)13-5-9-19-6-2-1-3-7-19/h1-12,18H,13-17H2/b9-5+,12-11+ |
| InChIKey | RNBUFNIOWANATD-LCXVDEDSSA-N |
| XLogP | 4.21 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|