C26H29N3O2 — CID 76860309
N-cyclopropyl-4-[3-oxo-3-[4-(3-phenylprop-2-enyl)piperazin-1-yl]prop-1-enyl]benzamide (PubChem CID 76860309) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-cyclopropyl-4-[3-oxo-3-[4-(3-phenylprop-2-enyl)piperazin-1-yl]prop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[3-oxo-3-[4-(3-phenylprop-2-enyl)piperazin-1-yl]prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 76860309 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-cyclopropyl-4-[3-oxo-3-[4-(3-phenylprop-2-enyl)piperazin-1-yl]prop-1-enyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(C=CC(=O)N2CCN(CC=Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H29N3O2/c30-25(15-10-22-8-11-23(12-9-22)26(31)27-24-13-14-24)29-19-17-28(18-20-29)16-4-7-21-5-2-1-3-6-21/h1-12,15,24H,13-14,16-20H2,(H,27,31) |
| InChIKey | DWDQMSASDLSCMR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|