C22H25N3O4S — CID 30297359
N-[1-[(E)-3-[4-(methanesulfonamido)phenyl]prop-2-enoyl]piperidin-4-yl]benzamide (PubChem CID 30297359) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[1-[(E)-3-[4-(methanesulfonamido)phenyl]prop-2-enoyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[(E)-3-[4-(methanesulfonamido)phenyl]prop-2-enoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 30297359 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[1-[(E)-3-[4-(methanesulfonamido)phenyl]prop-2-enoyl]piperidin-4-yl]benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)N2CCC(NC(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-30(28,29)24-20-10-7-17(8-11-20)9-12-21(26)25-15-13-19(14-16-25)23-22(27)18-5-3-2-4-6-18/h2-12,19,24H,13-16H2,1H3,(H,23,27)/b12-9+ |
| InChIKey | AIWSIGPUHSOKRV-FMIVXFBMSA-N |
| XLogP | 2.49 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|