C20H22ClN3O3S — CID 46557565
N-[4-[(E)-3-[4-(2-chlorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methanesulfonamide (PubChem CID 46557565) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is N-[4-[(E)-3-[4-(2-chlorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-3-[4-(2-chlorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 46557565 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-[4-[(E)-3-[4-(2-chlorophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)N2CCN(c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H22ClN3O3S/c1-28(26,27)22-17-9-6-16(7-10-17)8-11-20(25)24-14-12-23(13-15-24)19-5-3-2-4-18(19)21/h2-11,22H,12-15H2,1H3/b11-8+ |
| InChIKey | CEKWPBCSFKEMRE-DHZHZOJOSA-N |
| XLogP | 3.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|