C21H23ClN2O — CID 9209995
(E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-(4-ethylphenyl)prop-2-en-1-one (PubChem CID 9209995) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-(4-ethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-(4-ethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9209995 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-(4-ethylphenyl)prop-2-en-1-one |
| SMILES | CCc1ccc(/C=C/C(=O)N2CCN(c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H23ClN2O/c1-2-17-7-9-18(10-8-17)11-12-21(25)24-15-13-23(14-16-24)20-6-4-3-5-19(20)22/h3-12H,2,13-16H2,1H3/b12-11+ |
| InChIKey | DHRJZGGSOXPQHB-VAWYXSNFSA-N |
| XLogP | 4.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|