C21H22F2N2O3S — CID 9156812
(E)-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-(4-ethylphenyl)prop-2-en-1-one (PubChem CID 9156812) has the molecular formula C21H22F2N2O3S and a molecular weight of 420.48 g/mol. Its IUPAC name is (E)-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-(4-ethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-(4-ethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9156812 |
| Molecular Formula | C21H22F2N2O3S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (E)-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-(4-ethylphenyl)prop-2-en-1-one |
| SMILES | CCc1ccc(/C=C/C(=O)N2CCN(S(=O)(=O)c3c(F)cccc3F)CC2)cc1 |
| InChI | InChI=1S/C21H22F2N2O3S/c1-2-16-6-8-17(9-7-16)10-11-20(26)24-12-14-25(15-13-24)29(27,28)21-18(22)4-3-5-19(21)23/h3-11H,2,12-15H2,1H3/b11-10+ |
| InChIKey | SQEFPBJHSYYABR-ZHACJKMWSA-N |
| XLogP | 3.07 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|