C19H17Cl2FN2O3S — CID 26778338
(E)-1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one (PubChem CID 26778338) has the molecular formula C19H17Cl2FN2O3S and a molecular weight of 443.33 g/mol. Its IUPAC name is (E)-1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 26778338 |
| Molecular Formula | C19H17Cl2FN2O3S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | (E)-1-[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-3-(3-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(F)c1)N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C19H17Cl2FN2O3S/c20-16-5-2-6-17(21)19(16)28(26,27)24-11-9-23(10-12-24)18(25)8-7-14-3-1-4-15(22)13-14/h1-8,13H,9-12H2/b8-7+ |
| InChIKey | YBRGKJUMQZNZRV-BQYQJAHWSA-N |
| XLogP | 3.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|