C19H17ClF2N2O3S — CID 27676791
(E)-3-(4-chlorophenyl)-1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 27676791) has the molecular formula C19H17ClF2N2O3S and a molecular weight of 426.87 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 27676791 |
| Molecular Formula | C19H17ClF2N2O3S |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H17ClF2N2O3S/c20-15-4-1-14(2-5-15)3-8-19(25)23-9-11-24(12-10-23)28(26,27)18-7-6-16(21)13-17(18)22/h1-8,13H,9-12H2/b8-3+ |
| InChIKey | XBJMPQIEAXVUOQ-FPYGCLRLSA-N |
| XLogP | 3.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|