C20H20F2N2O3S — CID 26869931
(E)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 26869931) has the molecular formula C20H20F2N2O3S and a molecular weight of 406.45 g/mol. Its IUPAC name is (E)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 26869931 |
| Molecular Formula | C20H20F2N2O3S |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (E)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H20F2N2O3S/c1-15-2-4-16(5-3-15)6-9-20(25)23-10-12-24(13-11-23)28(26,27)17-7-8-18(21)19(22)14-17/h2-9,14H,10-13H2,1H3/b9-6+ |
| InChIKey | REFOUEMMMPWAJZ-RMKNXTFCSA-N |
| XLogP | 2.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|