C20H17ClF2N2O5S — CID 30485299
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 30485299) has the molecular formula C20H17ClF2N2O5S and a molecular weight of 470.88 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 30485299 |
| Molecular Formula | C20H17ClF2N2O5S |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H17ClF2N2O5S/c21-15-9-13(10-18-20(15)30-12-29-18)1-4-19(26)24-5-7-25(8-6-24)31(27,28)14-2-3-16(22)17(23)11-14/h1-4,9-11H,5-8,12H2/b4-1+ |
| InChIKey | UOLHSHISORUMAA-DAFODLJHSA-N |
| XLogP | 2.89 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|