C19H16Cl2F2N2O3S — CID 26869539
(E)-3-(2,3-dichlorophenyl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 26869539) has the molecular formula C19H16Cl2F2N2O3S and a molecular weight of 461.32 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26869539 |
| Molecular Formula | C19H16Cl2F2N2O3S |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1Cl)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H16Cl2F2N2O3S/c20-15-3-1-2-13(19(15)21)4-7-18(26)24-8-10-25(11-9-24)29(27,28)14-5-6-16(22)17(23)12-14/h1-7,12H,8-11H2/b7-4+ |
| InChIKey | CBSKGSQXWYRBNL-QPJJXVBHSA-N |
| XLogP | 3.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|