C20H17Cl2N3O3S — CID 78772731
2-[4-[3-(2,3-dichlorophenyl)prop-2-enoyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 78772731) has the molecular formula C20H17Cl2N3O3S and a molecular weight of 450.35 g/mol. Its IUPAC name is 2-[4-[3-(2,3-dichlorophenyl)prop-2-enoyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[3-(2,3-dichlorophenyl)prop-2-enoyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 78772731 |
| Molecular Formula | C20H17Cl2N3O3S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 2-[4-[3-(2,3-dichlorophenyl)prop-2-enoyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(C(=O)C=Cc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C20H17Cl2N3O3S/c21-17-6-3-5-15(20(17)22)8-9-19(26)24-10-12-25(13-11-24)29(27,28)18-7-2-1-4-16(18)14-23/h1-9H,10-13H2 |
| InChIKey | GUKOJCYGRGXWQO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|